C22H24N2O7 — CID 56580203
dimethyl 5-[3-[[benzyl(methyl)carbamoyl]amino]propanoyloxy]benzene-1,3-dicarboxylate (PubChem CID 56580203) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is dimethyl 5-[3-[[benzyl(methyl)carbamoyl]amino]propanoyloxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[[benzyl(methyl)carbamoyl]amino]propanoyloxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 56580203 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | dimethyl 5-[3-[[benzyl(methyl)carbamoyl]amino]propanoyloxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)CCNC(=O)N(C)Cc2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H24N2O7/c1-24(14-15-7-5-4-6-8-15)22(28)23-10-9-19(25)31-18-12-16(20(26)29-2)11-17(13-18)21(27)30-3/h4-8,11-13H,9-10,14H2,1-3H3,(H,23,28) |
| InChIKey | SKZAEIDKHDJYSF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|