C21H25BrN2O3 — CID 26690458
1-[4-[[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]methyl]phenyl]pyrrolidin-2-one (PubChem CID 26690458) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 1-[4-[[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]methyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]methyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26690458 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[4-[[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]methyl]phenyl]pyrrolidin-2-one |
| SMILES | CCOc1cc(CNCc2ccc(N3CCCC3=O)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C21H25BrN2O3/c1-3-27-19-12-16(11-18(22)21(19)26-2)14-23-13-15-6-8-17(9-7-15)24-10-4-5-20(24)25/h6-9,11-12,23H,3-5,10,13-14H2,1-2H3 |
| InChIKey | MGVCUFTVLSBNBU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |