C24H27N3O — CID 26692426
[4-(3-methylphenyl)piperazin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone (PubChem CID 26692426) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is [4-(3-methylphenyl)piperazin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone.
| Compound Name | [4-(3-methylphenyl)piperazin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 26692426 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [4-(3-methylphenyl)piperazin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3cc(C(C)C)nc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-17(2)23-16-21(20-9-4-5-10-22(20)25-23)24(28)27-13-11-26(12-14-27)19-8-6-7-18(3)15-19/h4-10,15-17H,11-14H2,1-3H3 |
| InChIKey | RAXCBTJLKWKZKS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |