C15H10Cl2N2O3S — CID 26699911
4-chloro-N-(3-chloro-4-cyanophenyl)-3-methylsulfonylbenzamide (PubChem CID 26699911) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-4-cyanophenyl)-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3-chloro-4-cyanophenyl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 26699911 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 4-chloro-N-(3-chloro-4-cyanophenyl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)Nc2ccc(C#N)c(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C15H10Cl2N2O3S/c1-23(21,22)14-6-9(3-5-12(14)16)15(20)19-11-4-2-10(8-18)13(17)7-11/h2-7H,1H3,(H,19,20) |
| InChIKey | FMFPGPSSVFEFPM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |