C21H16Cl2N2O4S — CID 55466634
4-chloro-N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-3-methylsulfonylbenzamide (PubChem CID 55466634) has the molecular formula C21H16Cl2N2O4S and a molecular weight of 463.34 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55466634 |
| Molecular Formula | C21H16Cl2N2O4S |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 4-chloro-N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O4S/c1-30(28,29)19-12-13(6-11-17(19)23)20(26)25-18-5-3-2-4-16(18)21(27)24-15-9-7-14(22)8-10-15/h2-12H,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZTWGUKWZCHIEHJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |