C26H28N2O6 — CID 26717739
N'-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 26717739) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is N'-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 26717739 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N'-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NNC(=O)c2ccc(COc3ccccc3)o2)cc1OCC |
| InChI | InChI=1S/C26H28N2O6/c1-3-16-32-22-13-10-19(17-24(22)31-4-2)11-15-25(29)27-28-26(30)23-14-12-21(34-23)18-33-20-8-6-5-7-9-20/h5-15,17H,3-4,16,18H2,1-2H3,(H,27,29)(H,28,30)/b15-11+ |
| InChIKey | MTPAKZMXOJRLCB-RVDMUPIBSA-N |
| XLogP | 4.52 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|