C23H26ClN5O2S — CID 26720372
N-(3-acetamidophenyl)-3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]propanamide (PubChem CID 26720372) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]propanamide.
| Compound Name | N-(3-acetamidophenyl)-3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 26720372 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-(3-acetamidophenyl)-3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]propanamide |
| SMILES | CCCCn1c(-c2ccc(Cl)cc2)nn(CCC(=O)Nc2cccc(NC(C)=O)c2)c1=S |
| InChI | InChI=1S/C23H26ClN5O2S/c1-3-4-13-28-22(17-8-10-18(24)11-9-17)27-29(23(28)32)14-12-21(31)26-20-7-5-6-19(15-20)25-16(2)30/h5-11,15H,3-4,12-14H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | FAHWTGSMKQAFEI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|