C25H26ClN5O2S — CID 55949788
3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide (PubChem CID 55949788) has the molecular formula C25H26ClN5O2S and a molecular weight of 496.04 g/mol. Its IUPAC name is 3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide.
| Compound Name | 3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 55949788 |
| Molecular Formula | C25H26ClN5O2S |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[4-butyl-3-(4-chlorophenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)CCn2nc(-c3ccc(Cl)cc3)n(CCCC)c2=S)c1 |
| InChI | InChI=1S/C25H26ClN5O2S/c1-3-5-14-30-24(19-9-11-20(26)12-10-19)29-31(25(30)34)15-13-22(32)27-17-23(33)28-21-8-6-7-18(4-2)16-21/h2,6-12,16H,3,5,13-15,17H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | XZBOLCYCFXICAV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|