C16H14Cl2N2O3S — CID 26731366
N-[(2,3-dichlorophenyl)methyl]-N-methyl-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 26731366) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-N-methyl-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-N-methyl-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 26731366 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-N-methyl-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-19(9-11-3-2-4-14(17)16(11)18)15(21)10-24-13-7-5-12(6-8-13)20(22)23/h2-8H,9-10H2,1H3 |
| InChIKey | NXXNZSKLKYQSOQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|