C17H17Cl2N3O3 — CID 55351839
2-[(2,3-dichlorophenyl)methyl-methylamino]-N-(4-nitrophenyl)propanamide (PubChem CID 55351839) has the molecular formula C17H17Cl2N3O3 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methyl-methylamino]-N-(4-nitrophenyl)propanamide.
| Compound Name | 2-[(2,3-dichlorophenyl)methyl-methylamino]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55351839 |
| Molecular Formula | C17H17Cl2N3O3 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methyl-methylamino]-N-(4-nitrophenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc([N+](=O)[O-])cc1)N(C)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl2N3O3/c1-11(21(2)10-12-4-3-5-15(18)16(12)19)17(23)20-13-6-8-14(9-7-13)22(24)25/h3-9,11H,10H2,1-2H3,(H,20,23) |
| InChIKey | RSTDZKKBVDQUOH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|