C12H11ClN4OS — CID 2678514
(2S)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylcyclopentan-1-one (PubChem CID 2678514) has the molecular formula C12H11ClN4OS and a molecular weight of 294.77 g/mol. Its IUPAC name is (2S)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylcyclopentan-1-one.
| Compound Name | (2S)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylcyclopentan-1-one |
|---|---|
| PubChem CID | 2678514 |
| Molecular Formula | C12H11ClN4OS |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (2S)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylcyclopentan-1-one |
| SMILES | O=C1CCC[C@@H]1Sc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN4OS/c13-8-4-6-9(7-5-8)17-12(14-15-16-17)19-11-3-1-2-10(11)18/h4-7,11H,1-3H2/t11-/m0/s1 |
| InChIKey | JDICRNQWDOTHSN-NSHDSACASA-N |
| XLogP | 2.53 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |