C22H24N2O3 — CID 26794050
N-[(1S,2S)-1-(1,3-benzodioxol-5-yl)-1-cyano-4,4-dimethylpentan-2-yl]benzamide (PubChem CID 26794050) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[(1S,2S)-1-(1,3-benzodioxol-5-yl)-1-cyano-4,4-dimethylpentan-2-yl]benzamide.
| Compound Name | N-[(1S,2S)-1-(1,3-benzodioxol-5-yl)-1-cyano-4,4-dimethylpentan-2-yl]benzamide |
|---|---|
| PubChem CID | 26794050 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(1S,2S)-1-(1,3-benzodioxol-5-yl)-1-cyano-4,4-dimethylpentan-2-yl]benzamide |
| SMILES | CC(C)(C)C[C@H](NC(=O)c1ccccc1)[C@@H](C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)12-18(24-21(25)15-7-5-4-6-8-15)17(13-23)16-9-10-19-20(11-16)27-14-26-19/h4-11,17-18H,12,14H2,1-3H3,(H,24,25)/t17-,18-/m0/s1 |
| InChIKey | SKYARZIGXUMASE-ROUUACIJSA-N |
| XLogP | 4.26 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |