C11H20N2 — CID 26794148
1-hexyl-2,5-dimethylimidazole (PubChem CID 26794148) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-hexyl-2,5-dimethylimidazole.
| Compound Name | 1-hexyl-2,5-dimethylimidazole |
|---|---|
| PubChem CID | 26794148 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-hexyl-2,5-dimethylimidazole |
| SMILES | CCCCCCn1c(C)cnc1C |
| InChI | InChI=1S/C11H20N2/c1-4-5-6-7-8-13-10(2)9-12-11(13)3/h9H,4-8H2,1-3H3 |
| InChIKey | XIVQXOCASHEHRQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|