C10H17ClN2O3 — CID 19766439
2-[3-(2,5-dimethylimidazol-1-yl)propoxy]acetic acid;hydrochloride (PubChem CID 19766439) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylimidazol-1-yl)propoxy]acetic acid;hydrochloride.
| Compound Name | 2-[3-(2,5-dimethylimidazol-1-yl)propoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 19766439 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[3-(2,5-dimethylimidazol-1-yl)propoxy]acetic acid;hydrochloride |
| SMILES | Cc1cnc(C)n1CCCOCC(=O)O.Cl |
| InChI | InChI=1S/C10H16N2O3.ClH/c1-8-6-11-9(2)12(8)4-3-5-15-7-10(13)14;/h6H,3-5,7H2,1-2H3,(H,13,14);1H |
| InChIKey | YDTNPIGBQCYOFU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|