C17H12IN3O3S — CID 26834190
N-[3-(5-iodofuran-2-yl)-1,2,4-thiadiazol-5-yl]-3,5-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 26834190) has the molecular formula C17H12IN3O3S and a molecular weight of 465.27 g/mol. Its IUPAC name is N-[3-(5-iodofuran-2-yl)-1,2,4-thiadiazol-5-yl]-3,5-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(5-iodofuran-2-yl)-1,2,4-thiadiazol-5-yl]-3,5-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26834190 |
| Molecular Formula | C17H12IN3O3S |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | N-[3-(5-iodofuran-2-yl)-1,2,4-thiadiazol-5-yl]-3,5-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)Nc3nc(-c4ccc(I)o4)ns3)c(C)c2c1 |
| InChI | InChI=1S/C17H12IN3O3S/c1-8-3-4-11-10(7-8)9(2)14(24-11)16(22)20-17-19-15(21-25-17)12-5-6-13(18)23-12/h3-7H,1-2H3,(H,19,20,21,22) |
| InChIKey | OQCRPFLEKLZRNA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|