C20H20ClN3O3 — CID 26877253
N-(5-chloro-2,4-dimethoxyphenyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide (PubChem CID 26877253) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26877253 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(-n3nc(C)cc3C)cc2)cc1Cl |
| InChI | InChI=1S/C20H20ClN3O3/c1-12-9-13(2)24(23-12)15-7-5-14(6-8-15)20(25)22-17-10-16(21)18(26-3)11-19(17)27-4/h5-11H,1-4H3,(H,22,25) |
| InChIKey | SCXMVCGUHWMALV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |