C21H22N2O3 — CID 26905155
N-[2-(2-ethylanilino)-2-oxoethyl]-2-(6-methyl-1-benzofuran-3-yl)acetamide (PubChem CID 26905155) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-2-(6-methyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-2-(6-methyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 26905155 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-2-(6-methyl-1-benzofuran-3-yl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)Cc1coc2cc(C)ccc12 |
| InChI | InChI=1S/C21H22N2O3/c1-3-15-6-4-5-7-18(15)23-21(25)12-22-20(24)11-16-13-26-19-10-14(2)8-9-17(16)19/h4-10,13H,3,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | DIYDSDTWTBOBIO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |