C22H22N2O4 — CID 2693380
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2693380) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2693380 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C22H22N2O4/c1-15-7-4-5-11-24(15)21(25)14-28-22(26)17-13-19(20-10-6-12-27-20)23-18-9-3-2-8-16(17)18/h2-3,6,8-10,12-13,15H,4-5,7,11,14H2,1H3/t15-/m1/s1 |
| InChIKey | UXAVZXXOQUXTNM-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |