C17H17BrF3N3O3S — CID 26943244
1-(5-bromo-2-methoxyphenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 26943244) has the molecular formula C17H17BrF3N3O3S and a molecular weight of 480.31 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 26943244 |
| Molecular Formula | C17H17BrF3N3O3S |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H17BrF3N3O3S/c1-27-14-4-3-13(18)10-15(14)28(25,26)24-8-6-23(7-9-24)16-5-2-12(11-22-16)17(19,20)21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | DMYJAAAJARHJRD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |