C13H11N3O7S — CID 26952272
N-(3-methoxyphenyl)-2,4-dinitrobenzenesulfonamide (PubChem CID 26952272) has the molecular formula C13H11N3O7S and a molecular weight of 353.31 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,4-dinitrobenzenesulfonamide.
| Compound Name | N-(3-methoxyphenyl)-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26952272 |
| Molecular Formula | C13H11N3O7S |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(3-methoxyphenyl)-2,4-dinitrobenzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N3O7S/c1-23-11-4-2-3-9(7-11)14-24(21,22)13-6-5-10(15(17)18)8-12(13)16(19)20/h2-8,14H,1H3 |
| InChIKey | WAKLZVXTTRAZRE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|