C20H22N4O3 — CID 26956071
(E)-3-(3,4-dimethoxyphenyl)-N-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)prop-2-enamide (PubChem CID 26956071) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26956071 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cnc3c(cnn3C(C)C)c2)cc1OC |
| InChI | InChI=1S/C20H22N4O3/c1-13(2)24-20-15(11-22-24)10-16(12-21-20)23-19(25)8-6-14-5-7-17(26-3)18(9-14)27-4/h5-13H,1-4H3,(H,23,25)/b8-6+ |
| InChIKey | LPJJVGHDYNEBBB-SOFGYWHQSA-N |
| XLogP | 3.68 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|