C21H23N5O3 — CID 71789833
(E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]prop-2-enamide (PubChem CID 71789833) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71789833 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cnc(-n3nc(C)c(C)c3C)nc2)cc1OC |
| InChI | InChI=1S/C21H23N5O3/c1-13-14(2)25-26(15(13)3)21-22-11-17(12-23-21)24-20(27)9-7-16-6-8-18(28-4)19(10-16)29-5/h6-12H,1-5H3,(H,24,27)/b9-7+ |
| InChIKey | SLFVTDPDQLCAMJ-VQHVLOKHSA-N |
| XLogP | 3.26 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|