C20H21N5O4 — CID 122301006
(E)-N-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 122301006) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is (E)-N-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122301006 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-N-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cnc(-n3ccnc3C)nc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N5O4/c1-13-21-7-8-25(13)20-22-11-15(12-23-20)24-18(26)6-5-14-9-16(27-2)19(29-4)17(10-14)28-3/h5-12H,1-4H3,(H,24,26)/b6-5+ |
| InChIKey | JIUZNKFHQPJLAX-AATRIKPKSA-N |
| XLogP | 2.65 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|