C26H29N5O4 — CID 122299297
(E)-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 122299297) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is (E)-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122299297 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (E)-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cnc(N3CCN(c4ccccc4)CC3)nc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H29N5O4/c1-33-22-15-19(16-23(34-2)25(22)35-3)9-10-24(32)29-20-17-27-26(28-18-20)31-13-11-30(12-14-31)21-7-5-4-6-8-21/h4-10,15-18H,11-14H2,1-3H3,(H,29,32)/b10-9+ |
| InChIKey | NJJYAEFPZBZJRM-MDZDMXLPSA-N |
| XLogP | 3.48 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|