C17H17BrN2O5S — CID 26965650
2-bromo-5-[[4-(2-methylpropanoylamino)phenyl]sulfamoyl]benzoic acid (PubChem CID 26965650) has the molecular formula C17H17BrN2O5S and a molecular weight of 441.30 g/mol. Its IUPAC name is 2-bromo-5-[[4-(2-methylpropanoylamino)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-bromo-5-[[4-(2-methylpropanoylamino)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 26965650 |
| Molecular Formula | C17H17BrN2O5S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 2-bromo-5-[[4-(2-methylpropanoylamino)phenyl]sulfamoyl]benzoic acid |
| SMILES | CC(C)C(=O)Nc1ccc(NS(=O)(=O)c2ccc(Br)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H17BrN2O5S/c1-10(2)16(21)19-11-3-5-12(6-4-11)20-26(24,25)13-7-8-15(18)14(9-13)17(22)23/h3-10,20H,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | WLRVHXGIEYEJAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |