C14H15N3OS — CID 26987208
(Z)-1-(4-ethylphenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]prop-2-en-1-one (PubChem CID 26987208) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is (Z)-1-(4-ethylphenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]prop-2-en-1-one.
| Compound Name | (Z)-1-(4-ethylphenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26987208 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (Z)-1-(4-ethylphenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]prop-2-en-1-one |
| SMILES | CCc1ccc(C(=O)/C=C\Sc2nncn2C)cc1 |
| InChI | InChI=1S/C14H15N3OS/c1-3-11-4-6-12(7-5-11)13(18)8-9-19-14-16-15-10-17(14)2/h4-10H,3H2,1-2H3/b9-8- |
| InChIKey | BQASDDZFHYHPLQ-HJWRWDBZSA-N |
| XLogP | 2.87 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|