C12H11N3OS — CID 27101086
(Z)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylprop-2-en-1-one (PubChem CID 27101086) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is (Z)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 27101086 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (Z)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylprop-2-en-1-one |
| SMILES | Cn1cnnc1S/C=C\C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11N3OS/c1-15-9-13-14-12(15)17-8-7-11(16)10-5-3-2-4-6-10/h2-9H,1H3/b8-7- |
| InChIKey | VGIZGERZMAZSFC-FPLPWBNLSA-N |
| XLogP | 2.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|