C22H26BrN3O5 — CID 26993493
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 26993493) has the molecular formula C22H26BrN3O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26993493 |
| Molecular Formula | C22H26BrN3O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | COc1cc(Br)c(CCNC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C22H26BrN3O5/c1-30-20-13-16(17(23)14-21(20)31-2)7-10-24-22(27)15-8-11-25(12-9-15)18-5-3-4-6-19(18)26(28)29/h3-6,13-15H,7-12H2,1-2H3,(H,24,27) |
| InChIKey | YFKXGRKKTFQNEZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|