C21H19ClFN3O3S — CID 26997042
[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone (PubChem CID 26997042) has the molecular formula C21H19ClFN3O3S and a molecular weight of 447.92 g/mol. Its IUPAC name is [4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone.
| Compound Name | [4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 26997042 |
| Molecular Formula | C21H19ClFN3O3S |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | [4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-n2cccc2)cc1)N1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H19ClFN3O3S/c22-19-15-18(7-8-20(19)23)30(28,29)26-13-11-25(12-14-26)21(27)16-3-5-17(6-4-16)24-9-1-2-10-24/h1-10,15H,11-14H2 |
| InChIKey | RDVLTEKVODHBAR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |