C18H13ClFN7 — CID 27001624
5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-(3-fluorophenyl)-N-methylpyrimidin-2-amine (PubChem CID 27001624) has the molecular formula C18H13ClFN7 and a molecular weight of 381.80 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-(3-fluorophenyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-(3-fluorophenyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 27001624 |
| Molecular Formula | C18H13ClFN7 |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-(3-fluorophenyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(-c2nnnn2-c2ccc(Cl)cc2)c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H13ClFN7/c1-21-18-22-10-15(16(23-18)11-3-2-4-13(20)9-11)17-24-25-26-27(17)14-7-5-12(19)6-8-14/h2-10H,1H3,(H,21,22,23) |
| InChIKey | BKRVXNQHXAUMFS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |