C12H10ClN7 — CID 2825835
5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-methylpyrimidin-2-amine (PubChem CID 2825835) has the molecular formula C12H10ClN7 and a molecular weight of 287.71 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-methylpyrimidin-2-amine.
| Compound Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 2825835 |
| Molecular Formula | C12H10ClN7 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1nc(N)ncc1-c1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN7/c1-7-10(6-15-12(14)16-7)11-17-18-19-20(11)9-4-2-8(13)3-5-9/h2-6H,1H3,(H2,14,15,16) |
| InChIKey | LCTAIOSSXUONCO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |