C20H19Cl2N3O3 — CID 27003765
N-[(Z)-(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetamide (PubChem CID 27003765) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 27003765 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=N\NC(=O)CN1C[C@@H](c2ccccc2)CC1=O |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-28-20-14(7-16(21)9-17(20)22)10-23-24-18(26)12-25-11-15(8-19(25)27)13-5-3-2-4-6-13/h2-7,9-10,15H,8,11-12H2,1H3,(H,24,26)/b23-10-/t15-/m0/s1 |
| InChIKey | KKHPTOGRABLGJF-MBTNSHOVSA-N |
| XLogP | 3.47 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|