C20H18BrN3O4 — CID 3674967
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide (PubChem CID 3674967) has the molecular formula C20H18BrN3O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 3674967 |
| Molecular Formula | C20H18BrN3O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CC(c2ccccc2)CC1=O)NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C20H18BrN3O4/c21-16-8-18-17(27-12-28-18)6-14(16)9-22-23-19(25)11-24-10-15(7-20(24)26)13-4-2-1-3-5-13/h1-6,8-9,15H,7,10-12H2,(H,23,25) |
| InChIKey | BNPBPAIOXUUEOG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|