C22H21BrN2O4 — CID 27004294
(E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-2-cyano-N-[(2R)-oxolan-2-yl]prop-2-enamide (PubChem CID 27004294) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-2-cyano-N-[(2R)-oxolan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-2-cyano-N-[(2R)-oxolan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 27004294 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-2-cyano-N-[(2R)-oxolan-2-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N[C@H]2CCCO2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H21BrN2O4/c1-27-19-12-16(10-17(13-24)22(26)25-20-8-5-9-28-20)11-18(23)21(19)29-14-15-6-3-2-4-7-15/h2-4,6-7,10-12,20H,5,8-9,14H2,1H3,(H,25,26)/b17-10+/t20-/m1/s1 |
| InChIKey | JMGXVYISDLUKHD-OTJDAXFFSA-N |
| XLogP | 4.20 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|