C18H12N4O8 — CID 27013833
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 27013833) has the molecular formula C18H12N4O8 and a molecular weight of 412.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 27013833 |
| Molecular Formula | C18H12N4O8 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H12N4O8/c23-15(20-18(26)19-9-1-4-13-14(5-9)30-8-29-13)7-21-16(24)11-3-2-10(22(27)28)6-12(11)17(21)25/h1-6H,7-8H2,(H2,19,20,23,26) |
| InChIKey | DYZPIFPEZMMNBB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|