C17H12ClN5O6 — CID 27031864
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate (PubChem CID 27031864) has the molecular formula C17H12ClN5O6 and a molecular weight of 417.77 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate |
|---|---|
| PubChem CID | 27031864 |
| Molecular Formula | C17H12ClN5O6 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1nnc2ccccc2c1=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12ClN5O6/c18-10-5-6-13(14(7-10)23(27)28)19-15(24)9-29-16(25)8-22-17(26)11-3-1-2-4-12(11)20-21-22/h1-7H,8-9H2,(H,19,24) |
| InChIKey | CXHNKMOXKQJNBC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|