C18H12ClN3O6 — CID 7504284
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 7504284) has the molecular formula C18H12ClN3O6 and a molecular weight of 401.76 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7504284 |
| Molecular Formula | C18H12ClN3O6 |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2[nH]1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12ClN3O6/c19-10-5-6-13(15(7-10)22(26)27)21-17(24)9-28-18(25)14-8-16(23)11-3-1-2-4-12(11)20-14/h1-8H,9H2,(H,20,23)(H,21,24) |
| InChIKey | XXDQHOPAKLLMAF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|