C10H9NO4 — CID 27059671
(2S)-5-acetyl-2-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 27059671) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is (2S)-5-acetyl-2-hydroxy-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-5-acetyl-2-hydroxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 27059671 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (2S)-5-acetyl-2-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)c1cccc2c1NC(=O)[C@@H](O)O2 |
| InChI | InChI=1S/C10H9NO4/c1-5(12)6-3-2-4-7-8(6)11-9(13)10(14)15-7/h2-4,10,14H,1H3,(H,11,13)/t10-/m0/s1 |
| InChIKey | SVPZYNXQSMWAQL-JTQLQIEISA-N |
| XLogP | 0.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |