C16H16IN3OS — CID 27059714
(2R)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]-2-pyridin-2-ylsulfanylpropanamide (PubChem CID 27059714) has the molecular formula C16H16IN3OS and a molecular weight of 425.30 g/mol. Its IUPAC name is (2R)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]-2-pyridin-2-ylsulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 27059714 |
| Molecular Formula | C16H16IN3OS |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | (2R)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Sc1ccccn1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H16IN3OS/c1-11(13-6-5-7-14(17)10-13)19-20-16(21)12(2)22-15-8-3-4-9-18-15/h3-10,12H,1-2H3,(H,20,21)/b19-11-/t12-/m1/s1 |
| InChIKey | CUCVGUBDKOCNAO-ZDFPAGSVSA-N |
| XLogP | 3.71 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|