C22H24ClN5O2S — CID 27080848
2-[[(4-chlorophenyl)methyl-methylamino]methyl]-4-(3-methoxypropyl)-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 27080848) has the molecular formula C22H24ClN5O2S and a molecular weight of 457.99 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)methyl-methylamino]methyl]-4-(3-methoxypropyl)-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 2-[[(4-chlorophenyl)methyl-methylamino]methyl]-4-(3-methoxypropyl)-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 27080848 |
| Molecular Formula | C22H24ClN5O2S |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-[[(4-chlorophenyl)methyl-methylamino]methyl]-4-(3-methoxypropyl)-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | COCCCn1c(=O)c2ccccc2n2c(=S)n(CN(C)Cc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C22H24ClN5O2S/c1-25(14-16-8-10-17(23)11-9-16)15-27-22(31)28-19-7-4-3-6-18(19)20(29)26(21(28)24-27)12-5-13-30-2/h3-4,6-11H,5,12-15H2,1-2H3 |
| InChIKey | ZIYQACJJTJDGMA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|