C19H21F2N3O2S — CID 27082496
1-[[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]methyl]-3-methylbenzimidazole-2-thione (PubChem CID 27082496) has the molecular formula C19H21F2N3O2S and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]methyl]-3-methylbenzimidazole-2-thione.
| Compound Name | 1-[[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]methyl]-3-methylbenzimidazole-2-thione |
|---|---|
| PubChem CID | 27082496 |
| Molecular Formula | C19H21F2N3O2S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]methyl]-3-methylbenzimidazole-2-thione |
| SMILES | COc1cc(CN(C)Cn2c(=S)n(C)c3ccccc32)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2N3O2S/c1-22(11-13-8-9-16(26-18(20)21)17(10-13)25-3)12-24-15-7-5-4-6-14(15)23(2)19(24)27/h4-10,18H,11-12H2,1-3H3 |
| InChIKey | QRTHWCPZRGBWBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|