C16H14BrN5O2 — CID 2709037
N-(4-bromo-3-methylphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 2709037) has the molecular formula C16H14BrN5O2 and a molecular weight of 388.23 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 2709037 |
| Molecular Formula | C16H14BrN5O2 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(-n3cnnn3)cc2)ccc1Br |
| InChI | InChI=1S/C16H14BrN5O2/c1-11-8-12(2-7-15(11)17)19-16(23)9-24-14-5-3-13(4-6-14)22-10-18-20-21-22/h2-8,10H,9H2,1H3,(H,19,23) |
| InChIKey | AHMKWOHXNSKYIX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |