C15H12BrN5O3S — CID 46428269
[2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 46428269) has the molecular formula C15H12BrN5O3S and a molecular weight of 422.26 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46428269 |
| Molecular Formula | C15H12BrN5O3S |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2sccc2-n2cnnn2)ccc1Br |
| InChI | InChI=1S/C15H12BrN5O3S/c1-9-6-10(2-3-11(9)16)18-13(22)7-24-15(23)14-12(4-5-25-14)21-8-17-19-20-21/h2-6,8H,7H2,1H3,(H,18,22) |
| InChIKey | JLJLSABOLBRXBM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |