C17H17N5O4S — CID 55704699
[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 55704699) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate.
| Compound Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55704699 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
| SMILES | Cc1cccc(OCCNC(=O)COC(=O)c2sccc2-n2cnnn2)c1 |
| InChI | InChI=1S/C17H17N5O4S/c1-12-3-2-4-13(9-12)25-7-6-18-15(23)10-26-17(24)16-14(5-8-27-16)22-11-19-20-21-22/h2-5,8-9,11H,6-7,10H2,1H3,(H,18,23) |
| InChIKey | CGQGYJAXYNULQM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|