C15H13N5O3S2 — CID 154860819
[2-(4-methylsulfanylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 154860819) has the molecular formula C15H13N5O3S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is [2-(4-methylsulfanylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate.
| Compound Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 154860819 |
| Molecular Formula | C15H13N5O3S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
| SMILES | CSc1ccc(NC(=O)COC(=O)c2sccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C15H13N5O3S2/c1-24-11-4-2-10(3-5-11)17-13(21)8-23-15(22)14-12(6-7-25-14)20-9-16-18-19-20/h2-7,9H,8H2,1H3,(H,17,21) |
| InChIKey | ZQBLHLRYFFAWAL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |