C12H14N4O4S — CID 46428081
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 46428081) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46428081 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-(tetrazol-1-yl)thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)COC(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C12H14N4O4S/c1-12(2,3)20-9(17)6-19-11(18)10-8(4-5-21-10)16-7-13-14-15-16/h4-5,7H,6H2,1-3H3 |
| InChIKey | OVSCSWBUFJGIGO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |