C14H10N4O3S — CID 46428094
phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 46428094) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate.
| Compound Name | phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46428094 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sccc1-n1cnnn1)c1ccccc1 |
| InChI | InChI=1S/C14H10N4O3S/c19-12(10-4-2-1-3-5-10)8-21-14(20)13-11(6-7-22-13)18-9-15-16-17-18/h1-7,9H,8H2 |
| InChIKey | LUTZOVUUYIEHOV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |