phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate

C14H10N4O3S — CID 46428094

IUPACphenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate
SMILESO=C(COC(=O)c1sccc1-n1cnnn1)c1ccccc1
InChIInChI=1S/C14H10N4O3S/c19-12(10-4-2-1-3-5-10)8-21-14(20)13-11(6-7-22-13)18-9-15-16-17-18/h1-7,9H,8H2
InChIKeyLUTZOVUUYIEHOV-UHFFFAOYSA-N
MW314.33 g/mol
LogP1.76
Rot. Bonds5

About phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate

phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate (PubChem CID 46428094) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate.

Molecular Properties

Compound Namephenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate
PubChem CID46428094
Molecular FormulaC14H10N4O3S
Molecular Weight314.33 g/mol
Exact Mass314.05
IUPAC Namephenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate
SMILESO=C(COC(=O)c1sccc1-n1cnnn1)c1ccccc1
InChIInChI=1S/C14H10N4O3S/c19-12(10-4-2-1-3-5-10)8-21-14(20)13-11(6-7-22-13)18-9-15-16-17-18/h1-7,9H,8H2
InChIKeyLUTZOVUUYIEHOV-UHFFFAOYSA-N
XLogP1.76
TPSA86.97 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.33
LogP ≤ 51.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate?
The IUPAC name of phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate (CID 46428094) is phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate.
What is the SMILES notation for phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate?
The canonical SMILES for phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate is O=C(COC(=O)c1sccc1-n1cnnn1)c1ccccc1.
What is the InChIKey of phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate?
The InChIKey is LUTZOVUUYIEHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3S/c19-12(10-4-2-1-3-5-10)8-21-14(20)13-11(6-7-22-13)18-9-15-16-17-18/h1-7,9H,8H2.
What are the key properties of phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate?
phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate has a molecular weight of 314.33 g/mol, XLogP of 1.76, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 3-(tetrazol-1-yl)thiophene-2-carboxylate is sourced from PubChem (CID 46428094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).