C17H21N3O3S2 — CID 27101666
N-(2-methoxyethylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide (PubChem CID 27101666) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(2-methoxyethylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide.
| Compound Name | N-(2-methoxyethylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 27101666 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2-methoxyethylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide |
| SMILES | COCCNC(=O)NC(=O)CN1CCc2sccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-23-8-6-18-17(22)19-15(21)11-20-7-4-13-12(5-10-25-13)16(20)14-3-2-9-24-14/h2-3,5,9-10,16H,4,6-8,11H2,1H3,(H2,18,19,21,22)/t16-/m1/s1 |
| InChIKey | SETNPHOGWPFMBO-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|