C18H23N3O2S2 — CID 9129482
N-(butylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide (PubChem CID 9129482) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 9129482 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(butylcarbamoyl)-2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN1CCc2sccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H23N3O2S2/c1-2-3-8-19-18(23)20-16(22)12-21-9-6-14-13(7-11-25-14)17(21)15-5-4-10-24-15/h4-5,7,10-11,17H,2-3,6,8-9,12H2,1H3,(H2,19,20,22,23)/t17-/m1/s1 |
| InChIKey | NXJBTGWRVYYKQX-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|