C18H22N2O3S2 — CID 9129396
methyl 4-[[2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]amino]butanoate (PubChem CID 9129396) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 9129396 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 4-[[2-[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1CCc2sccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-23-17(22)5-2-8-19-16(21)12-20-9-6-14-13(7-11-25-14)18(20)15-4-3-10-24-15/h3-4,7,10-11,18H,2,5-6,8-9,12H2,1H3,(H,19,21)/t18-/m1/s1 |
| InChIKey | HVYSUONKPFZYAA-GOSISDBHSA-N |
| XLogP | 2.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|